C17H33N3O — CID 79413710
1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-N-ethyl-2,3-dimethylpiperidin-4-amine (PubChem CID 79413710) has the molecular formula C17H33N3O and a molecular weight of 295.47 g/mol. Its IUPAC name is 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-N-ethyl-2,3-dimethylpiperidin-4-amine.
| Compound Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-N-ethyl-2,3-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 79413710 |
| Molecular Formula | C17H33N3O |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.26 |
| IUPAC Name | 1-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-ylmethyl)-N-ethyl-2,3-dimethylpiperidin-4-amine |
| SMILES | CCNC1CCN(CC2CN3CCCC3CO2)C(C)C1C |
| InChI | InChI=1S/C17H33N3O/c1-4-18-17-7-9-19(14(3)13(17)2)10-16-11-20-8-5-6-15(20)12-21-16/h13-18H,4-12H2,1-3H3 |
| InChIKey | GFCCLHYYKAVBIY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |