C13H27BrO2 — CID 112587495
3-(bromomethyl)-3-[2-[(2-methylpropan-2-yl)oxy]ethoxymethyl]pentane (PubChem CID 112587495) has the molecular formula C13H27BrO2 and a molecular weight of 295.26 g/mol. Its IUPAC name is 3-(bromomethyl)-3-[2-[(2-methylpropan-2-yl)oxy]ethoxymethyl]pentane.
| Compound Name | 3-(bromomethyl)-3-[2-[(2-methylpropan-2-yl)oxy]ethoxymethyl]pentane |
|---|---|
| PubChem CID | 112587495 |
| Molecular Formula | C13H27BrO2 |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 3-(bromomethyl)-3-[2-[(2-methylpropan-2-yl)oxy]ethoxymethyl]pentane |
| SMILES | CCC(CC)(CBr)COCCOC(C)(C)C |
| InChI | InChI=1S/C13H27BrO2/c1-6-13(7-2,10-14)11-15-8-9-16-12(3,4)5/h6-11H2,1-5H3 |
| InChIKey | YEEDTJBCLBBXSC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|