C12H20N2O3S — CID 112588091
2-[(2-methylpropan-2-yl)oxy]ethyl 2-(1-aminoethyl)-1,3-thiazole-4-carboxylate (PubChem CID 112588091) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxy]ethyl 2-(1-aminoethyl)-1,3-thiazole-4-carboxylate.
| Compound Name | 2-[(2-methylpropan-2-yl)oxy]ethyl 2-(1-aminoethyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 112588091 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxy]ethyl 2-(1-aminoethyl)-1,3-thiazole-4-carboxylate |
| SMILES | CC(N)c1nc(C(=O)OCCOC(C)(C)C)cs1 |
| InChI | InChI=1S/C12H20N2O3S/c1-8(13)10-14-9(7-18-10)11(15)16-5-6-17-12(2,3)4/h7-8H,5-6,13H2,1-4H3 |
| InChIKey | HBVSXSJCFYNMPJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|