C15H11Br2N3O2S — CID 11259623
4,6-dibromo-2-[2-(4-nitrophenyl)ethylsulfanyl]-1H-benzimidazole (PubChem CID 11259623) has the molecular formula C15H11Br2N3O2S and a molecular weight of 457.15 g/mol. Its IUPAC name is 4,6-dibromo-2-[2-(4-nitrophenyl)ethylsulfanyl]-1H-benzimidazole.
| Compound Name | 4,6-dibromo-2-[2-(4-nitrophenyl)ethylsulfanyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 11259623 |
| Molecular Formula | C15H11Br2N3O2S |
| Molecular Weight | 457.15 g/mol |
| Exact Mass | 454.89 |
| IUPAC Name | 4,6-dibromo-2-[2-(4-nitrophenyl)ethylsulfanyl]-1H-benzimidazole |
| SMILES | O=[N+]([O-])c1ccc(CCSc2nc3c(Br)cc(Br)cc3[nH]2)cc1 |
| InChI | InChI=1S/C15H11Br2N3O2S/c16-10-7-12(17)14-13(8-10)18-15(19-14)23-6-5-9-1-3-11(4-2-9)20(21)22/h1-4,7-8H,5-6H2,(H,18,19) |
| InChIKey | ZSQLSNLOAAFMBJ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.15 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|