C24H32N2O7 — CID 11259712
5-O-benzyl 2-O-tert-butyl (1R,4R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxo-2,5-diazaspiro[3.4]octane-2,5-dicarboxylate (PubChem CID 11259712) has the molecular formula C24H32N2O7 and a molecular weight of 460.53 g/mol. Its IUPAC name is 5-O-benzyl 2-O-tert-butyl (1R,4R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxo-2,5-diazaspiro[3.4]octane-2,5-dicarboxylate.
| Compound Name | 5-O-benzyl 2-O-tert-butyl (1R,4R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxo-2,5-diazaspiro[3.4]octane-2,5-dicarboxylate |
|---|---|
| PubChem CID | 11259712 |
| Molecular Formula | C24H32N2O7 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 5-O-benzyl 2-O-tert-butyl (1R,4R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxo-2,5-diazaspiro[3.4]octane-2,5-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@@]2(CCCN2C(=O)OCc2ccccc2)[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C24H32N2O7/c1-22(2,3)33-21(29)26-18(17-15-31-23(4,5)32-17)24(19(26)27)12-9-13-25(24)20(28)30-14-16-10-7-6-8-11-16/h6-8,10-11,17-18H,9,12-15H2,1-5H3/t17-,18+,24-/m1/s1 |
| InChIKey | FKGFDPJYZXZMMG-NXMSCROESA-N |
| XLogP | 3.46 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |