C7H9N3O4 — CID 112597783
2-(2,4,6-trioxo-1,3-diazinan-1-yl)propanamide (PubChem CID 112597783) has the molecular formula C7H9N3O4 and a molecular weight of 199.17 g/mol. Its IUPAC name is 2-(2,4,6-trioxo-1,3-diazinan-1-yl)propanamide.
| Compound Name | 2-(2,4,6-trioxo-1,3-diazinan-1-yl)propanamide |
|---|---|
| PubChem CID | 112597783 |
| Molecular Formula | C7H9N3O4 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 2-(2,4,6-trioxo-1,3-diazinan-1-yl)propanamide |
| SMILES | CC(C(N)=O)N1C(=O)CC(=O)NC1=O |
| InChI | InChI=1S/C7H9N3O4/c1-3(6(8)13)10-5(12)2-4(11)9-7(10)14/h3H,2H2,1H3,(H2,8,13)(H,9,11,14) |
| InChIKey | CTJBLGCAESAUAF-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|