C10H5F3N2O3 — CID 112598353
1-(3,4-difluorophenyl)-5-fluoro-6-hydroxypyrimidine-2,4-dione (PubChem CID 112598353) has the molecular formula C10H5F3N2O3 and a molecular weight of 258.15 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-5-fluoro-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-(3,4-difluorophenyl)-5-fluoro-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 112598353 |
| Molecular Formula | C10H5F3N2O3 |
| Molecular Weight | 258.15 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 1-(3,4-difluorophenyl)-5-fluoro-6-hydroxypyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2ccc(F)c(F)c2)c(O)c1F |
| InChI | InChI=1S/C10H5F3N2O3/c11-5-2-1-4(3-6(5)12)15-9(17)7(13)8(16)14-10(15)18/h1-3,17H,(H,14,16,18) |
| InChIKey | JZADIURJBKDJDM-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.15 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |