C10H4Cl3FN2O3 — CID 112599156
5-fluoro-6-hydroxy-1-(2,4,6-trichlorophenyl)pyrimidine-2,4-dione (PubChem CID 112599156) has the molecular formula C10H4Cl3FN2O3 and a molecular weight of 325.51 g/mol. Its IUPAC name is 5-fluoro-6-hydroxy-1-(2,4,6-trichlorophenyl)pyrimidine-2,4-dione.
| Compound Name | 5-fluoro-6-hydroxy-1-(2,4,6-trichlorophenyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 112599156 |
| Molecular Formula | C10H4Cl3FN2O3 |
| Molecular Weight | 325.51 g/mol |
| Exact Mass | 323.93 |
| IUPAC Name | 5-fluoro-6-hydroxy-1-(2,4,6-trichlorophenyl)pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2c(Cl)cc(Cl)cc2Cl)c(O)c1F |
| InChI | InChI=1S/C10H4Cl3FN2O3/c11-3-1-4(12)7(5(13)2-3)16-9(18)6(14)8(17)15-10(16)19/h1-2,18H,(H,15,17,19) |
| InChIKey | KYQBIDYJJISVKF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.51 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |