C10H4BrCl2FN2O3 — CID 107795625
1-(4-bromo-2,3-dichlorophenyl)-5-fluoro-6-hydroxypyrimidine-2,4-dione (PubChem CID 107795625) has the molecular formula C10H4BrCl2FN2O3 and a molecular weight of 369.96 g/mol. Its IUPAC name is 1-(4-bromo-2,3-dichlorophenyl)-5-fluoro-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-(4-bromo-2,3-dichlorophenyl)-5-fluoro-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 107795625 |
| Molecular Formula | C10H4BrCl2FN2O3 |
| Molecular Weight | 369.96 g/mol |
| Exact Mass | 367.88 |
| IUPAC Name | 1-(4-bromo-2,3-dichlorophenyl)-5-fluoro-6-hydroxypyrimidine-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(-c2ccc(Br)c(Cl)c2Cl)c(O)c1F |
| InChI | InChI=1S/C10H4BrCl2FN2O3/c11-3-1-2-4(6(13)5(3)12)16-9(18)7(14)8(17)15-10(16)19/h1-2,18H,(H,15,17,19) |
| InChIKey | PLZNIGOJHFXBEF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.96 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|