C11H8BrFN2O4 — CID 112600912
1-(2-bromo-5-methoxyphenyl)-5-fluoro-6-hydroxypyrimidine-2,4-dione (PubChem CID 112600912) has the molecular formula C11H8BrFN2O4 and a molecular weight of 331.10 g/mol. Its IUPAC name is 1-(2-bromo-5-methoxyphenyl)-5-fluoro-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-(2-bromo-5-methoxyphenyl)-5-fluoro-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 112600912 |
| Molecular Formula | C11H8BrFN2O4 |
| Molecular Weight | 331.10 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | 1-(2-bromo-5-methoxyphenyl)-5-fluoro-6-hydroxypyrimidine-2,4-dione |
| SMILES | COc1ccc(Br)c(-n2c(O)c(F)c(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C11H8BrFN2O4/c1-19-5-2-3-6(12)7(4-5)15-10(17)8(13)9(16)14-11(15)18/h2-4,17H,1H3,(H,14,16,18) |
| InChIKey | XICCXVHERIKBLP-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.10 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |