C29H37N5O2 — CID 11260308
1-[2-[(2-methylquinolin-4-yl)carbamoylamino]ethyl]-N-(4-phenylbutyl)piperidine-3-carboxamide (PubChem CID 11260308) has the molecular formula C29H37N5O2 and a molecular weight of 487.65 g/mol. Its IUPAC name is 1-[2-[(2-methylquinolin-4-yl)carbamoylamino]ethyl]-N-(4-phenylbutyl)piperidine-3-carboxamide.
| Compound Name | 1-[2-[(2-methylquinolin-4-yl)carbamoylamino]ethyl]-N-(4-phenylbutyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 11260308 |
| Molecular Formula | C29H37N5O2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | 1-[2-[(2-methylquinolin-4-yl)carbamoylamino]ethyl]-N-(4-phenylbutyl)piperidine-3-carboxamide |
| SMILES | Cc1cc(NC(=O)NCCN2CCCC(C(=O)NCCCCc3ccccc3)C2)c2ccccc2n1 |
| InChI | InChI=1S/C29H37N5O2/c1-22-20-27(25-14-5-6-15-26(25)32-22)33-29(36)31-17-19-34-18-9-13-24(21-34)28(35)30-16-8-7-12-23-10-3-2-4-11-23/h2-6,10-11,14-15,20,24H,7-9,12-13,16-19,21H2,1H3,(H,30,35)(H2,31,32,33,36) |
| InChIKey | GHPMHURKOLBZDC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|