C25H30BrN5O3S — CID 90763388
1-[2-[3-[[4-(2-bromoethyl)phenyl]sulfonylamino]pyrrolidin-1-yl]ethyl]-3-(2-methylquinolin-4-yl)urea (PubChem CID 90763388) has the molecular formula C25H30BrN5O3S and a molecular weight of 560.52 g/mol. Its IUPAC name is 1-[2-[3-[[4-(2-bromoethyl)phenyl]sulfonylamino]pyrrolidin-1-yl]ethyl]-3-(2-methylquinolin-4-yl)urea.
| Compound Name | 1-[2-[3-[[4-(2-bromoethyl)phenyl]sulfonylamino]pyrrolidin-1-yl]ethyl]-3-(2-methylquinolin-4-yl)urea |
|---|---|
| PubChem CID | 90763388 |
| Molecular Formula | C25H30BrN5O3S |
| Molecular Weight | 560.52 g/mol |
| Exact Mass | 559.13 |
| IUPAC Name | 1-[2-[3-[[4-(2-bromoethyl)phenyl]sulfonylamino]pyrrolidin-1-yl]ethyl]-3-(2-methylquinolin-4-yl)urea |
| SMILES | Cc1cc(NC(=O)NCCN2CCC(NS(=O)(=O)c3ccc(CCBr)cc3)C2)c2ccccc2n1 |
| InChI | InChI=1S/C25H30BrN5O3S/c1-18-16-24(22-4-2-3-5-23(22)28-18)29-25(32)27-13-15-31-14-11-20(17-31)30-35(33,34)21-8-6-19(7-9-21)10-12-26/h2-9,16,20,30H,10-15,17H2,1H3,(H2,27,28,29,32) |
| InChIKey | INQBXPOYLFCMRC-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|