C12H17N5O2 — CID 112606179
2,4-dimethoxy-6-(1-propyltetrazol-5-yl)aniline (PubChem CID 112606179) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 2,4-dimethoxy-6-(1-propyltetrazol-5-yl)aniline.
| Compound Name | 2,4-dimethoxy-6-(1-propyltetrazol-5-yl)aniline |
|---|---|
| PubChem CID | 112606179 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 2,4-dimethoxy-6-(1-propyltetrazol-5-yl)aniline |
| SMILES | CCCn1nnnc1-c1cc(OC)cc(OC)c1N |
| InChI | InChI=1S/C12H17N5O2/c1-4-5-17-12(14-15-16-17)9-6-8(18-2)7-10(19-3)11(9)13/h6-7H,4-5,13H2,1-3H3 |
| InChIKey | ONTDNFGTWUFFFE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|