C26H29BF4NO4P — CID 11261175
[2-methoxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoethyl]-triphenylphosphanium tetrafluoroborate (PubChem CID 11261175) has the molecular formula C26H29BF4NO4P and a molecular weight of 537.30 g/mol. Its IUPAC name is [2-methoxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoethyl]-triphenylphosphanium tetrafluoroborate.
| Compound Name | [2-methoxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoethyl]-triphenylphosphanium tetrafluoroborate |
|---|---|
| PubChem CID | 11261175 |
| Molecular Formula | C26H29BF4NO4P |
| Molecular Weight | 537.30 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | [2-methoxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]-2-oxoethyl]-triphenylphosphanium tetrafluoroborate |
| SMILES | COC(=O)C(NC(=O)OC(C)(C)C)[P+](c1ccccc1)(c1ccccc1)c1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C26H28NO4P.BF4/c1-26(2,3)31-25(29)27-23(24(28)30-4)32(20-14-8-5-9-15-20,21-16-10-6-11-17-21)22-18-12-7-13-19-22;2-1(3,4)5/h5-19,23H,1-4H3;/q;-1/p+1 |
| InChIKey | XKZAELAQMRFPMV-UHFFFAOYSA-O |
| XLogP | 5.30 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.30 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|