C11H19NO3 — CID 112617445
methyl 2-(3,3-diethylpyrrolidin-1-yl)-2-oxoacetate (PubChem CID 112617445) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is methyl 2-(3,3-diethylpyrrolidin-1-yl)-2-oxoacetate.
| Compound Name | methyl 2-(3,3-diethylpyrrolidin-1-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 112617445 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | methyl 2-(3,3-diethylpyrrolidin-1-yl)-2-oxoacetate |
| SMILES | CCC1(CC)CCN(C(=O)C(=O)OC)C1 |
| InChI | InChI=1S/C11H19NO3/c1-4-11(5-2)6-7-12(8-11)9(13)10(14)15-3/h4-8H2,1-3H3 |
| InChIKey | GFCLVMMQACLOBV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|