C13H26N2OS — CID 113254039
3,3-diethyl-N-(1-methoxypropan-2-yl)pyrrolidine-1-carbothioamide (PubChem CID 113254039) has the molecular formula C13H26N2OS and a molecular weight of 258.43 g/mol. Its IUPAC name is 3,3-diethyl-N-(1-methoxypropan-2-yl)pyrrolidine-1-carbothioamide.
| Compound Name | 3,3-diethyl-N-(1-methoxypropan-2-yl)pyrrolidine-1-carbothioamide |
|---|---|
| PubChem CID | 113254039 |
| Molecular Formula | C13H26N2OS |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 3,3-diethyl-N-(1-methoxypropan-2-yl)pyrrolidine-1-carbothioamide |
| SMILES | CCC1(CC)CCN(C(=S)NC(C)COC)C1 |
| InChI | InChI=1S/C13H26N2OS/c1-5-13(6-2)7-8-15(10-13)12(17)14-11(3)9-16-4/h11H,5-10H2,1-4H3,(H,14,17) |
| InChIKey | JAODTYWPPFLZFK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|