C11H23N3OS — CID 115570223
N-(1-methoxypropan-2-yl)-4-methyl-1,4-diazepane-1-carbothioamide (PubChem CID 115570223) has the molecular formula C11H23N3OS and a molecular weight of 245.39 g/mol. Its IUPAC name is N-(1-methoxypropan-2-yl)-4-methyl-1,4-diazepane-1-carbothioamide.
| Compound Name | N-(1-methoxypropan-2-yl)-4-methyl-1,4-diazepane-1-carbothioamide |
|---|---|
| PubChem CID | 115570223 |
| Molecular Formula | C11H23N3OS |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | N-(1-methoxypropan-2-yl)-4-methyl-1,4-diazepane-1-carbothioamide |
| SMILES | COCC(C)NC(=S)N1CCCN(C)CC1 |
| InChI | InChI=1S/C11H23N3OS/c1-10(9-15-3)12-11(16)14-6-4-5-13(2)7-8-14/h10H,4-9H2,1-3H3,(H,12,16) |
| InChIKey | UEIXMMQVGGGRCG-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|