C12H8BrN3S — CID 112618374
4-(5-bromoquinolin-8-yl)-1,3-thiazol-5-amine (PubChem CID 112618374) has the molecular formula C12H8BrN3S and a molecular weight of 306.19 g/mol. Its IUPAC name is 4-(5-bromoquinolin-8-yl)-1,3-thiazol-5-amine.
| Compound Name | 4-(5-bromoquinolin-8-yl)-1,3-thiazol-5-amine |
|---|---|
| PubChem CID | 112618374 |
| Molecular Formula | C12H8BrN3S |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 304.96 |
| IUPAC Name | 4-(5-bromoquinolin-8-yl)-1,3-thiazol-5-amine |
| SMILES | Nc1scnc1-c1ccc(Br)c2cccnc12 |
| InChI | InChI=1S/C12H8BrN3S/c13-9-4-3-8(11-12(14)17-6-16-11)10-7(9)2-1-5-15-10/h1-6H,14H2 |
| InChIKey | FTGAITRBMVXMCC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |