C13H12BrNO3 — CID 112620556
5-bromo-3-methyl-2-[(5-methyl-1,2-oxazol-3-yl)methoxy]benzaldehyde (PubChem CID 112620556) has the molecular formula C13H12BrNO3 and a molecular weight of 310.15 g/mol. Its IUPAC name is 5-bromo-3-methyl-2-[(5-methyl-1,2-oxazol-3-yl)methoxy]benzaldehyde.
| Compound Name | 5-bromo-3-methyl-2-[(5-methyl-1,2-oxazol-3-yl)methoxy]benzaldehyde |
|---|---|
| PubChem CID | 112620556 |
| Molecular Formula | C13H12BrNO3 |
| Molecular Weight | 310.15 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 5-bromo-3-methyl-2-[(5-methyl-1,2-oxazol-3-yl)methoxy]benzaldehyde |
| SMILES | Cc1cc(COc2c(C)cc(Br)cc2C=O)no1 |
| InChI | InChI=1S/C13H12BrNO3/c1-8-3-11(14)5-10(6-16)13(8)17-7-12-4-9(2)18-15-12/h3-6H,7H2,1-2H3 |
| InChIKey | OENSHDVHXZLRKL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.15 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|