About [3,5-dibromo-4-[(5-methyl-1,2-oxazol-3-yl)methoxy]phenyl]methanol
[3,5-dibromo-4-[(5-methyl-1,2-oxazol-3-yl)methoxy]phenyl]methanol (PubChem CID 107738846) has the molecular formula C12H11Br2NO3
and a molecular weight of 377.03 g/mol. Its IUPAC name is [3,5-dibromo-4-[(5-methyl-1,2-oxazol-3-yl)methoxy]phenyl]methanol.
Molecular Properties
| Compound Name | [3,5-dibromo-4-[(5-methyl-1,2-oxazol-3-yl)methoxy]phenyl]methanol |
| PubChem CID | 107738846 |
| Molecular Formula | C12H11Br2NO3 |
| Molecular Weight | 377.03 g/mol |
| Exact Mass | 374.91 |
| IUPAC Name | [3,5-dibromo-4-[(5-methyl-1,2-oxazol-3-yl)methoxy]phenyl]methanol |
| SMILES | Cc1cc(COc2c(Br)cc(CO)cc2Br)no1 |
| InChI | InChI=1S/C12H11Br2NO3/c1-7-2-9(15-18-7)6-17-12-10(13)3-8(5-16)4-11(12)14/h2-4,16H,5-6H2,1H3 |
| InChIKey | OMFVAZDWDKCEBR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.03 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3,5-dibromo-4-[(5-methyl-1,2-oxazol-3-yl)methoxy]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-dibromo-4-[(5-methyl-1,2-oxazol-3-yl)methoxy]phenyl]methanol?
The IUPAC name of [3,5-dibromo-4-[(5-methyl-1,2-oxazol-3-yl)methoxy]phenyl]methanol (CID 107738846) is [3,5-dibromo-4-[(5-methyl-1,2-oxazol-3-yl)methoxy]phenyl]methanol.
What is the SMILES notation for [3,5-dibromo-4-[(5-methyl-1,2-oxazol-3-yl)methoxy]phenyl]methanol?
The canonical SMILES for [3,5-dibromo-4-[(5-methyl-1,2-oxazol-3-yl)methoxy]phenyl]methanol is Cc1cc(COc2c(Br)cc(CO)cc2Br)no1.
What is the InChIKey of [3,5-dibromo-4-[(5-methyl-1,2-oxazol-3-yl)methoxy]phenyl]methanol?
The InChIKey is OMFVAZDWDKCEBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Br2NO3/c1-7-2-9(15-18-7)6-17-12-10(13)3-8(5-16)4-11(12)14/h2-4,16H,5-6H2,1H3.
What are the key properties of [3,5-dibromo-4-[(5-methyl-1,2-oxazol-3-yl)methoxy]phenyl]methanol?
[3,5-dibromo-4-[(5-methyl-1,2-oxazol-3-yl)methoxy]phenyl]methanol has a molecular weight of 377.03 g/mol, XLogP of 3.58, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-dibromo-4-[(5-methyl-1,2-oxazol-3-yl)methoxy]phenyl]methanol is sourced from PubChem (CID 107738846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).