C11H8Br3NO2 — CID 112797269
5-methyl-3-[(2,4,6-tribromophenoxy)methyl]-1,2-oxazole (PubChem CID 112797269) has the molecular formula C11H8Br3NO2 and a molecular weight of 425.90 g/mol. Its IUPAC name is 5-methyl-3-[(2,4,6-tribromophenoxy)methyl]-1,2-oxazole.
| Compound Name | 5-methyl-3-[(2,4,6-tribromophenoxy)methyl]-1,2-oxazole |
|---|---|
| PubChem CID | 112797269 |
| Molecular Formula | C11H8Br3NO2 |
| Molecular Weight | 425.90 g/mol |
| Exact Mass | 422.81 |
| IUPAC Name | 5-methyl-3-[(2,4,6-tribromophenoxy)methyl]-1,2-oxazole |
| SMILES | Cc1cc(COc2c(Br)cc(Br)cc2Br)no1 |
| InChI | InChI=1S/C11H8Br3NO2/c1-6-2-8(15-17-6)5-16-11-9(13)3-7(12)4-10(11)14/h2-4H,5H2,1H3 |
| InChIKey | VMRACJLEPXIKHE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.90 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |