C49H54NP — CID 11262493
1-[2-bis(3,5-ditert-butylphenyl)phosphanylnaphthalen-1-yl]naphthalene-2-carbonitrile (PubChem CID 11262493) has the molecular formula C49H54NP and a molecular weight of 687.95 g/mol. Its IUPAC name is 1-[2-bis(3,5-ditert-butylphenyl)phosphanylnaphthalen-1-yl]naphthalene-2-carbonitrile.
| Compound Name | 1-[2-bis(3,5-ditert-butylphenyl)phosphanylnaphthalen-1-yl]naphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 11262493 |
| Molecular Formula | C49H54NP |
| Molecular Weight | 687.95 g/mol |
| Exact Mass | 687.40 |
| IUPAC Name | 1-[2-bis(3,5-ditert-butylphenyl)phosphanylnaphthalen-1-yl]naphthalene-2-carbonitrile |
| SMILES | CC(C)(C)c1cc(P(c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c2ccc3ccccc3c2-c2c(C#N)ccc3ccccc23)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C49H54NP/c1-46(2,3)35-25-36(47(4,5)6)28-39(27-35)51(40-29-37(48(7,8)9)26-38(30-40)49(10,11)12)43-24-23-33-18-14-16-20-42(33)45(43)44-34(31-50)22-21-32-17-13-15-19-41(32)44/h13-30H,1-12H3 |
| InChIKey | IZYUSHBFOVSZEE-UHFFFAOYSA-N |
| XLogP | 12.48 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.95 |
| LogP ≤ 5 | 12.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|