C10H15N7O — CID 112629759
[1-(6-hydrazinyl-1H-pyrazolo[5,4-d]pyrimidin-4-yl)pyrrolidin-3-yl]methanol (PubChem CID 112629759) has the molecular formula C10H15N7O and a molecular weight of 249.28 g/mol. Its IUPAC name is [1-(6-hydrazinyl-1H-pyrazolo[5,4-d]pyrimidin-4-yl)pyrrolidin-3-yl]methanol.
| Compound Name | [1-(6-hydrazinyl-1H-pyrazolo[5,4-d]pyrimidin-4-yl)pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 112629759 |
| Molecular Formula | C10H15N7O |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | [1-(6-hydrazinyl-1H-pyrazolo[5,4-d]pyrimidin-4-yl)pyrrolidin-3-yl]methanol |
| SMILES | NNc1nc(N2CCC(CO)C2)c2cn[nH]c2n1 |
| InChI | InChI=1S/C10H15N7O/c11-15-10-13-8-7(3-12-16-8)9(14-10)17-2-1-6(4-17)5-18/h3,6,18H,1-2,4-5,11H2,(H2,12,13,14,15,16) |
| InChIKey | OZSMCFAFXAHZGZ-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|