C11H19NO5 — CID 112632682
2-(4-hydroxy-2-methoxycarbonylpyrrolidin-1-yl)pentanoic acid (PubChem CID 112632682) has the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. Its IUPAC name is 2-(4-hydroxy-2-methoxycarbonylpyrrolidin-1-yl)pentanoic acid.
| Compound Name | 2-(4-hydroxy-2-methoxycarbonylpyrrolidin-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 112632682 |
| Molecular Formula | C11H19NO5 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 2-(4-hydroxy-2-methoxycarbonylpyrrolidin-1-yl)pentanoic acid |
| SMILES | CCCC(C(=O)O)N1CC(O)CC1C(=O)OC |
| InChI | InChI=1S/C11H19NO5/c1-3-4-8(10(14)15)12-6-7(13)5-9(12)11(16)17-2/h7-9,13H,3-6H2,1-2H3,(H,14,15) |
| InChIKey | TVUSJTNBPOQMKA-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |