C6H13NO2 — CID 112634236
3-(hydroxyamino)-2,2-dimethylcyclobutan-1-ol (PubChem CID 112634236) has the molecular formula C6H13NO2 and a molecular weight of 131.17 g/mol. Its IUPAC name is 3-(hydroxyamino)-2,2-dimethylcyclobutan-1-ol.
| Compound Name | 3-(hydroxyamino)-2,2-dimethylcyclobutan-1-ol |
|---|---|
| PubChem CID | 112634236 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.17 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | 3-(hydroxyamino)-2,2-dimethylcyclobutan-1-ol |
| SMILES | CC1(C)C(O)CC1NO |
| InChI | InChI=1S/C6H13NO2/c1-6(2)4(7-9)3-5(6)8/h4-5,7-9H,3H2,1-2H3 |
| InChIKey | UIOLZKWFFXCHHY-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.17 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|