C11H17Cl2N3O — CID 112635793
N-(1,3-dichloro-2-methylpropan-2-yl)-4-ethoxy-6-methylpyrimidin-2-amine (PubChem CID 112635793) has the molecular formula C11H17Cl2N3O and a molecular weight of 278.18 g/mol. Its IUPAC name is N-(1,3-dichloro-2-methylpropan-2-yl)-4-ethoxy-6-methylpyrimidin-2-amine.
| Compound Name | N-(1,3-dichloro-2-methylpropan-2-yl)-4-ethoxy-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 112635793 |
| Molecular Formula | C11H17Cl2N3O |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | N-(1,3-dichloro-2-methylpropan-2-yl)-4-ethoxy-6-methylpyrimidin-2-amine |
| SMILES | CCOc1cc(C)nc(NC(C)(CCl)CCl)n1 |
| InChI | InChI=1S/C11H17Cl2N3O/c1-4-17-9-5-8(2)14-10(15-9)16-11(3,6-12)7-13/h5H,4,6-7H2,1-3H3,(H,14,15,16) |
| InChIKey | CLDHJMGLKQIBCL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|