C12H21N3O3S — CID 112638194
4-ethoxy-6-methyl-N-(2-methyl-2-methylsulfonylpropyl)pyrimidin-2-amine (PubChem CID 112638194) has the molecular formula C12H21N3O3S and a molecular weight of 287.39 g/mol. Its IUPAC name is 4-ethoxy-6-methyl-N-(2-methyl-2-methylsulfonylpropyl)pyrimidin-2-amine.
| Compound Name | 4-ethoxy-6-methyl-N-(2-methyl-2-methylsulfonylpropyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112638194 |
| Molecular Formula | C12H21N3O3S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 4-ethoxy-6-methyl-N-(2-methyl-2-methylsulfonylpropyl)pyrimidin-2-amine |
| SMILES | CCOc1cc(C)nc(NCC(C)(C)S(C)(=O)=O)n1 |
| InChI | InChI=1S/C12H21N3O3S/c1-6-18-10-7-9(2)14-11(15-10)13-8-12(3,4)19(5,16)17/h7H,6,8H2,1-5H3,(H,13,14,15) |
| InChIKey | PCJXOXIISSUYPB-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |