C10H15Cl2N3O — CID 112639440
N-(1,3-dichloro-2-methylpropan-2-yl)-4-ethoxypyrimidin-2-amine (PubChem CID 112639440) has the molecular formula C10H15Cl2N3O and a molecular weight of 264.16 g/mol. Its IUPAC name is N-(1,3-dichloro-2-methylpropan-2-yl)-4-ethoxypyrimidin-2-amine.
| Compound Name | N-(1,3-dichloro-2-methylpropan-2-yl)-4-ethoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 112639440 |
| Molecular Formula | C10H15Cl2N3O |
| Molecular Weight | 264.16 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | N-(1,3-dichloro-2-methylpropan-2-yl)-4-ethoxypyrimidin-2-amine |
| SMILES | CCOc1ccnc(NC(C)(CCl)CCl)n1 |
| InChI | InChI=1S/C10H15Cl2N3O/c1-3-16-8-4-5-13-9(14-8)15-10(2,6-11)7-12/h4-5H,3,6-7H2,1-2H3,(H,13,14,15) |
| InChIKey | XAPUQRAQWLDFCU-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.16 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|