C9H8ClNOS2 — CID 112642016
1-(4-chlorothiophen-2-yl)-2-(1,3-thiazol-5-yl)ethanol (PubChem CID 112642016) has the molecular formula C9H8ClNOS2 and a molecular weight of 245.76 g/mol. Its IUPAC name is 1-(4-chlorothiophen-2-yl)-2-(1,3-thiazol-5-yl)ethanol.
| Compound Name | 1-(4-chlorothiophen-2-yl)-2-(1,3-thiazol-5-yl)ethanol |
|---|---|
| PubChem CID | 112642016 |
| Molecular Formula | C9H8ClNOS2 |
| Molecular Weight | 245.76 g/mol |
| Exact Mass | 244.97 |
| IUPAC Name | 1-(4-chlorothiophen-2-yl)-2-(1,3-thiazol-5-yl)ethanol |
| SMILES | OC(Cc1cncs1)c1cc(Cl)cs1 |
| InChI | InChI=1S/C9H8ClNOS2/c10-6-1-9(13-4-6)8(12)2-7-3-11-5-14-7/h1,3-5,8,12H,2H2 |
| InChIKey | MYCWIRBZRUKYOW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.76 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |