C11H13FN2O3S — CID 112646378
2-[(3-amino-5-fluorophenyl)methyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one (PubChem CID 112646378) has the molecular formula C11H13FN2O3S and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-[(3-amino-5-fluorophenyl)methyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one.
| Compound Name | 2-[(3-amino-5-fluorophenyl)methyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one |
|---|---|
| PubChem CID | 112646378 |
| Molecular Formula | C11H13FN2O3S |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 2-[(3-amino-5-fluorophenyl)methyl]-4,4-dimethyl-1,1-dioxothiazetidin-3-one |
| SMILES | CC1(C)C(=O)N(Cc2cc(N)cc(F)c2)S1(=O)=O |
| InChI | InChI=1S/C11H13FN2O3S/c1-11(2)10(15)14(18(11,16)17)6-7-3-8(12)5-9(13)4-7/h3-5H,6,13H2,1-2H3 |
| InChIKey | WVRJMRQPHCQWEK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|