C14H18O5 — CID 11265596
methyl 2-hexoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate (PubChem CID 11265596) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is methyl 2-hexoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate.
| Compound Name | methyl 2-hexoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 11265596 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | methyl 2-hexoxy-3,6-dioxocyclohexa-1,4-diene-1-carboxylate |
| SMILES | CCCCCCOC1=C(C(=O)OC)C(=O)C=CC1=O |
| InChI | InChI=1S/C14H18O5/c1-3-4-5-6-9-19-13-11(16)8-7-10(15)12(13)14(17)18-2/h7-8H,3-6,9H2,1-2H3 |
| InChIKey | OFTFNPAQKIJDHF-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|