C9H20N2S — CID 112660799
N'-methyl-N'-(2-methylsulfanylethyl)-N-prop-2-enylethane-1,2-diamine (PubChem CID 112660799) has the molecular formula C9H20N2S and a molecular weight of 188.34 g/mol. Its IUPAC name is N'-methyl-N'-(2-methylsulfanylethyl)-N-prop-2-enylethane-1,2-diamine.
| Compound Name | N'-methyl-N'-(2-methylsulfanylethyl)-N-prop-2-enylethane-1,2-diamine |
|---|---|
| PubChem CID | 112660799 |
| Molecular Formula | C9H20N2S |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | N'-methyl-N'-(2-methylsulfanylethyl)-N-prop-2-enylethane-1,2-diamine |
| SMILES | C=CCNCCN(C)CCSC |
| InChI | InChI=1S/C9H20N2S/c1-4-5-10-6-7-11(2)8-9-12-3/h4,10H,1,5-9H2,2-3H3 |
| InChIKey | ODJCLIXIMOMXLX-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|