C13H22ClN3S — CID 112664254
5-chloro-6-[[methyl(2-methylsulfanylethyl)amino]methyl]-N-propylpyridin-2-amine (PubChem CID 112664254) has the molecular formula C13H22ClN3S and a molecular weight of 287.86 g/mol. Its IUPAC name is 5-chloro-6-[[methyl(2-methylsulfanylethyl)amino]methyl]-N-propylpyridin-2-amine.
| Compound Name | 5-chloro-6-[[methyl(2-methylsulfanylethyl)amino]methyl]-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 112664254 |
| Molecular Formula | C13H22ClN3S |
| Molecular Weight | 287.86 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 5-chloro-6-[[methyl(2-methylsulfanylethyl)amino]methyl]-N-propylpyridin-2-amine |
| SMILES | CCCNc1ccc(Cl)c(CN(C)CCSC)n1 |
| InChI | InChI=1S/C13H22ClN3S/c1-4-7-15-13-6-5-11(14)12(16-13)10-17(2)8-9-18-3/h5-6H,4,7-10H2,1-3H3,(H,15,16) |
| InChIKey | NKIKPFHDLQKSQF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.86 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |