C12H19ClN2OS — CID 55127556
5-chloro-6-(2-methoxyethylsulfanylmethyl)-N-propylpyridin-2-amine (PubChem CID 55127556) has the molecular formula C12H19ClN2OS and a molecular weight of 274.82 g/mol. Its IUPAC name is 5-chloro-6-(2-methoxyethylsulfanylmethyl)-N-propylpyridin-2-amine.
| Compound Name | 5-chloro-6-(2-methoxyethylsulfanylmethyl)-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 55127556 |
| Molecular Formula | C12H19ClN2OS |
| Molecular Weight | 274.82 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 5-chloro-6-(2-methoxyethylsulfanylmethyl)-N-propylpyridin-2-amine |
| SMILES | CCCNc1ccc(Cl)c(CSCCOC)n1 |
| InChI | InChI=1S/C12H19ClN2OS/c1-3-6-14-12-5-4-10(13)11(15-12)9-17-8-7-16-2/h4-5H,3,6-9H2,1-2H3,(H,14,15) |
| InChIKey | MXRIKTQOTOXSKV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.82 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|