C17H21ClN2S — CID 63485717
5-chloro-6-[(2-methylphenyl)methylsulfanylmethyl]-N-propylpyridin-2-amine (PubChem CID 63485717) has the molecular formula C17H21ClN2S and a molecular weight of 320.89 g/mol. Its IUPAC name is 5-chloro-6-[(2-methylphenyl)methylsulfanylmethyl]-N-propylpyridin-2-amine.
| Compound Name | 5-chloro-6-[(2-methylphenyl)methylsulfanylmethyl]-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 63485717 |
| Molecular Formula | C17H21ClN2S |
| Molecular Weight | 320.89 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 5-chloro-6-[(2-methylphenyl)methylsulfanylmethyl]-N-propylpyridin-2-amine |
| SMILES | CCCNc1ccc(Cl)c(CSCc2ccccc2C)n1 |
| InChI | InChI=1S/C17H21ClN2S/c1-3-10-19-17-9-8-15(18)16(20-17)12-21-11-14-7-5-4-6-13(14)2/h4-9H,3,10-12H2,1-2H3,(H,19,20) |
| InChIKey | OVZKRQOSHOXGGT-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.89 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |