C13H21ClN2OS — CID 55262087
5-chloro-6-(3-methoxypropylsulfanylmethyl)-N-propylpyridin-2-amine (PubChem CID 55262087) has the molecular formula C13H21ClN2OS and a molecular weight of 288.84 g/mol. Its IUPAC name is 5-chloro-6-(3-methoxypropylsulfanylmethyl)-N-propylpyridin-2-amine.
| Compound Name | 5-chloro-6-(3-methoxypropylsulfanylmethyl)-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 55262087 |
| Molecular Formula | C13H21ClN2OS |
| Molecular Weight | 288.84 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 5-chloro-6-(3-methoxypropylsulfanylmethyl)-N-propylpyridin-2-amine |
| SMILES | CCCNc1ccc(Cl)c(CSCCCOC)n1 |
| InChI | InChI=1S/C13H21ClN2OS/c1-3-7-15-13-6-5-11(14)12(16-13)10-18-9-4-8-17-2/h5-6H,3-4,7-10H2,1-2H3,(H,15,16) |
| InChIKey | SRGQLPAUMKOLAC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.84 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|