C14H19BrO2 — CID 11266532
(1S,4R,5R,7R)-9-bromo-5-methyl-4-propan-2-yl-11-oxatricyclo[5.3.1.01,5]undec-8-en-10-one (PubChem CID 11266532) has the molecular formula C14H19BrO2 and a molecular weight of 299.21 g/mol. Its IUPAC name is (1S,4R,5R,7R)-9-bromo-5-methyl-4-propan-2-yl-11-oxatricyclo[5.3.1.01,5]undec-8-en-10-one.
| Compound Name | (1S,4R,5R,7R)-9-bromo-5-methyl-4-propan-2-yl-11-oxatricyclo[5.3.1.01,5]undec-8-en-10-one |
|---|---|
| PubChem CID | 11266532 |
| Molecular Formula | C14H19BrO2 |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | (1S,4R,5R,7R)-9-bromo-5-methyl-4-propan-2-yl-11-oxatricyclo[5.3.1.01,5]undec-8-en-10-one |
| SMILES | CC(C)[C@H]1CC[C@@]23O[C@@H](C=C(Br)C2=O)C[C@]13C |
| InChI | InChI=1S/C14H19BrO2/c1-8(2)10-4-5-14-12(16)11(15)6-9(17-14)7-13(10,14)3/h6,8-10H,4-5,7H2,1-3H3/t9-,10+,13+,14+/m0/s1 |
| InChIKey | QSASHYCUNAOXIK-GZZJDILISA-N |
| XLogP | 3.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|