C13H21NO3S2 — CID 112667028
1-[3-(hydroxymethyl)phenyl]-N-methyl-N-(1-methylsulfanylpropan-2-yl)methanesulfonamide (PubChem CID 112667028) has the molecular formula C13H21NO3S2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 1-[3-(hydroxymethyl)phenyl]-N-methyl-N-(1-methylsulfanylpropan-2-yl)methanesulfonamide.
| Compound Name | 1-[3-(hydroxymethyl)phenyl]-N-methyl-N-(1-methylsulfanylpropan-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 112667028 |
| Molecular Formula | C13H21NO3S2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 1-[3-(hydroxymethyl)phenyl]-N-methyl-N-(1-methylsulfanylpropan-2-yl)methanesulfonamide |
| SMILES | CSCC(C)N(C)S(=O)(=O)Cc1cccc(CO)c1 |
| InChI | InChI=1S/C13H21NO3S2/c1-11(9-18-3)14(2)19(16,17)10-13-6-4-5-12(7-13)8-15/h4-7,11,15H,8-10H2,1-3H3 |
| InChIKey | DKYOYKCJRSFWKQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |