C12H19ClN2O2S2 — CID 112667074
5-(chloromethyl)-1-cyclopropyl-N-methyl-N-(2-methylsulfanylethyl)pyrrole-3-sulfonamide (PubChem CID 112667074) has the molecular formula C12H19ClN2O2S2 and a molecular weight of 322.88 g/mol. Its IUPAC name is 5-(chloromethyl)-1-cyclopropyl-N-methyl-N-(2-methylsulfanylethyl)pyrrole-3-sulfonamide.
| Compound Name | 5-(chloromethyl)-1-cyclopropyl-N-methyl-N-(2-methylsulfanylethyl)pyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 112667074 |
| Molecular Formula | C12H19ClN2O2S2 |
| Molecular Weight | 322.88 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 5-(chloromethyl)-1-cyclopropyl-N-methyl-N-(2-methylsulfanylethyl)pyrrole-3-sulfonamide |
| SMILES | CSCCN(C)S(=O)(=O)c1cc(CCl)n(C2CC2)c1 |
| InChI | InChI=1S/C12H19ClN2O2S2/c1-14(5-6-18-2)19(16,17)12-7-11(8-13)15(9-12)10-3-4-10/h7,9-10H,3-6,8H2,1-2H3 |
| InChIKey | DYFWAAYJYARKME-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.88 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|