C18H32O4 — CID 11266964
2-[(2S,4S,5R,6S)-4,5-dimethoxy-2,6-dimethylnon-7-ynoxy]oxane (PubChem CID 11266964) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is 2-[(2S,4S,5R,6S)-4,5-dimethoxy-2,6-dimethylnon-7-ynoxy]oxane.
| Compound Name | 2-[(2S,4S,5R,6S)-4,5-dimethoxy-2,6-dimethylnon-7-ynoxy]oxane |
|---|---|
| PubChem CID | 11266964 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 2-[(2S,4S,5R,6S)-4,5-dimethoxy-2,6-dimethylnon-7-ynoxy]oxane |
| SMILES | CC#C[C@H](C)[C@@H](OC)[C@H](C[C@H](C)COC1CCCCO1)OC |
| InChI | InChI=1S/C18H32O4/c1-6-9-15(3)18(20-5)16(19-4)12-14(2)13-22-17-10-7-8-11-21-17/h14-18H,7-8,10-13H2,1-5H3/t14-,15-,16-,17?,18+/m0/s1 |
| InChIKey | CDVUTSODMXZPBE-NHOPAOFGSA-N |
| XLogP | 3.25 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|