C18H32O4 — CID 134962886
(4R,5S,6S)-4-[(2S)-2-(methoxymethoxy)hex-4-ynyl]-2,2,5-trimethyl-6-propan-2-yl-1,3-dioxane (PubChem CID 134962886) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is (4R,5S,6S)-4-[(2S)-2-(methoxymethoxy)hex-4-ynyl]-2,2,5-trimethyl-6-propan-2-yl-1,3-dioxane.
| Compound Name | (4R,5S,6S)-4-[(2S)-2-(methoxymethoxy)hex-4-ynyl]-2,2,5-trimethyl-6-propan-2-yl-1,3-dioxane |
|---|---|
| PubChem CID | 134962886 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | (4R,5S,6S)-4-[(2S)-2-(methoxymethoxy)hex-4-ynyl]-2,2,5-trimethyl-6-propan-2-yl-1,3-dioxane |
| SMILES | CC#CC[C@@H](C[C@H]1OC(C)(C)O[C@@H](C(C)C)[C@H]1C)OCOC |
| InChI | InChI=1S/C18H32O4/c1-8-9-10-15(20-12-19-7)11-16-14(4)17(13(2)3)22-18(5,6)21-16/h13-17H,10-12H2,1-7H3/t14-,15-,16+,17-/m0/s1 |
| InChIKey | KQOMUQZMSYOQBW-NXOAAHMSSA-N |
| XLogP | 3.59 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|