C23H46O2 — CID 14805774
2-[(2R,6R,10R)-6,10,14-trimethylpentadecan-2-yl]oxyoxane (PubChem CID 14805774) has the molecular formula C23H46O2 and a molecular weight of 354.62 g/mol. Its IUPAC name is 2-[(2R,6R,10R)-6,10,14-trimethylpentadecan-2-yl]oxyoxane.
| Compound Name | 2-[(2R,6R,10R)-6,10,14-trimethylpentadecan-2-yl]oxyoxane |
|---|---|
| PubChem CID | 14805774 |
| Molecular Formula | C23H46O2 |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 354.35 |
| IUPAC Name | 2-[(2R,6R,10R)-6,10,14-trimethylpentadecan-2-yl]oxyoxane |
| SMILES | CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@@H](C)OC1CCCCO1 |
| InChI | InChI=1S/C23H46O2/c1-19(2)11-8-12-20(3)13-9-14-21(4)15-10-16-22(5)25-23-17-6-7-18-24-23/h19-23H,6-18H2,1-5H3/t20-,21-,22-,23?/m1/s1 |
| InChIKey | ZKVWMILCZFGOCD-YRNFEDNZSA-N |
| XLogP | 7.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |