C13H25IO4 — CID 135038231
(2S,3R,4S,6S)-6-(iodomethyl)-4-methoxy-2-[(2S)-1-(methoxymethoxy)propan-2-yl]-3-methyloxane (PubChem CID 135038231) has the molecular formula C13H25IO4 and a molecular weight of 372.24 g/mol. Its IUPAC name is (2S,3R,4S,6S)-6-(iodomethyl)-4-methoxy-2-[(2S)-1-(methoxymethoxy)propan-2-yl]-3-methyloxane.
| Compound Name | (2S,3R,4S,6S)-6-(iodomethyl)-4-methoxy-2-[(2S)-1-(methoxymethoxy)propan-2-yl]-3-methyloxane |
|---|---|
| PubChem CID | 135038231 |
| Molecular Formula | C13H25IO4 |
| Molecular Weight | 372.24 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | (2S,3R,4S,6S)-6-(iodomethyl)-4-methoxy-2-[(2S)-1-(methoxymethoxy)propan-2-yl]-3-methyloxane |
| SMILES | COCOC[C@H](C)[C@@H]1O[C@H](CI)C[C@H](OC)[C@H]1C |
| InChI | InChI=1S/C13H25IO4/c1-9(7-17-8-15-3)13-10(2)12(16-4)5-11(6-14)18-13/h9-13H,5-8H2,1-4H3/t9-,10+,11-,12-,13-/m0/s1 |
| InChIKey | YZFARQUXKNWSDO-PPCPHDFISA-N |
| XLogP | 2.49 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|