C16H27AlO2 — CID 138971086
dimethyl-[(3S)-3-[(2S,3R,6S)-3-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]but-1-ynyl]alumane (PubChem CID 138971086) has the molecular formula C16H27AlO2 and a molecular weight of 278.37 g/mol. Its IUPAC name is dimethyl-[(3S)-3-[(2S,3R,6S)-3-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]but-1-ynyl]alumane.
| Compound Name | dimethyl-[(3S)-3-[(2S,3R,6S)-3-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]but-1-ynyl]alumane |
|---|---|
| PubChem CID | 138971086 |
| Molecular Formula | C16H27AlO2 |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | dimethyl-[(3S)-3-[(2S,3R,6S)-3-methyl-1,7-dioxaspiro[5.5]undecan-2-yl]but-1-ynyl]alumane |
| SMILES | C[C@@H]1CC[C@]2(CCCCO2)O[C@@H]1[C@@H](C)C#C[Al](C)C |
| InChI | InChI=1S/C14H21O2.2CH3.Al/c1-4-11(2)13-12(3)7-9-14(16-13)8-5-6-10-15-14;;;/h11-13H,5-10H2,2-3H3;2*1H3;/t11-,12+,13+,14-;;;/m0.../s1 |
| InChIKey | IQFNRGWJGTWEMK-DVBTUHJXSA-N |
| XLogP | 3.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|