C11H15N3O2 — CID 112672973
2-(5,6,7,8-tetrahydroquinolin-8-ylamino)oxyacetamide (PubChem CID 112672973) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-(5,6,7,8-tetrahydroquinolin-8-ylamino)oxyacetamide.
| Compound Name | 2-(5,6,7,8-tetrahydroquinolin-8-ylamino)oxyacetamide |
|---|---|
| PubChem CID | 112672973 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-(5,6,7,8-tetrahydroquinolin-8-ylamino)oxyacetamide |
| SMILES | NC(=O)CONC1CCCc2cccnc21 |
| InChI | InChI=1S/C11H15N3O2/c12-10(15)7-16-14-9-5-1-3-8-4-2-6-13-11(8)9/h2,4,6,9,14H,1,3,5,7H2,(H2,12,15) |
| InChIKey | BUJCLYBSBGDGNG-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|