C10H12N2O2S — CID 112673301
2-(2,3-dihydro-1-benzothiophen-3-ylamino)oxyacetamide (PubChem CID 112673301) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzothiophen-3-ylamino)oxyacetamide.
| Compound Name | 2-(2,3-dihydro-1-benzothiophen-3-ylamino)oxyacetamide |
|---|---|
| PubChem CID | 112673301 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 2-(2,3-dihydro-1-benzothiophen-3-ylamino)oxyacetamide |
| SMILES | NC(=O)CONC1CSc2ccccc21 |
| InChI | InChI=1S/C10H12N2O2S/c11-10(13)5-14-12-8-6-15-9-4-2-1-3-7(8)9/h1-4,8,12H,5-6H2,(H2,11,13) |
| InChIKey | MXFXMLVNXHSTPS-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|