C6H12N4O4 — CID 112674251
2-amino-N-[2-[(2-amino-2-oxoethoxy)amino]-2-oxoethyl]acetamide (PubChem CID 112674251) has the molecular formula C6H12N4O4 and a molecular weight of 204.19 g/mol. Its IUPAC name is 2-amino-N-[2-[(2-amino-2-oxoethoxy)amino]-2-oxoethyl]acetamide.
| Compound Name | 2-amino-N-[2-[(2-amino-2-oxoethoxy)amino]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 112674251 |
| Molecular Formula | C6H12N4O4 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2-amino-N-[2-[(2-amino-2-oxoethoxy)amino]-2-oxoethyl]acetamide |
| SMILES | NCC(=O)NCC(=O)NOCC(N)=O |
| InChI | InChI=1S/C6H12N4O4/c7-1-5(12)9-2-6(13)10-14-3-4(8)11/h1-3,7H2,(H2,8,11)(H,9,12)(H,10,13) |
| InChIKey | NFZXRCSLDCZCPF-UHFFFAOYSA-N |
| XLogP | -3.41 |
| TPSA | 136.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | -3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|