C7H11N5O3 — CID 112674372
N-(2-amino-2-oxoethoxy)-5-ethyl-1H-1,2,4-triazole-3-carboxamide (PubChem CID 112674372) has the molecular formula C7H11N5O3 and a molecular weight of 213.20 g/mol. Its IUPAC name is N-(2-amino-2-oxoethoxy)-5-ethyl-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(2-amino-2-oxoethoxy)-5-ethyl-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 112674372 |
| Molecular Formula | C7H11N5O3 |
| Molecular Weight | 213.20 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | N-(2-amino-2-oxoethoxy)-5-ethyl-1H-1,2,4-triazole-3-carboxamide |
| SMILES | CCc1nc(C(=O)NOCC(N)=O)n[nH]1 |
| InChI | InChI=1S/C7H11N5O3/c1-2-5-9-6(11-10-5)7(14)12-15-3-4(8)13/h2-3H2,1H3,(H2,8,13)(H,12,14)(H,9,10,11) |
| InChIKey | CZMBUYQFVUVCLH-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 122.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.20 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|