C13H24N4O — CID 114138257
5-ethyl-N-octan-4-yl-1H-1,2,4-triazole-3-carboxamide (PubChem CID 114138257) has the molecular formula C13H24N4O and a molecular weight of 252.36 g/mol. Its IUPAC name is 5-ethyl-N-octan-4-yl-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-ethyl-N-octan-4-yl-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 114138257 |
| Molecular Formula | C13H24N4O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 5-ethyl-N-octan-4-yl-1H-1,2,4-triazole-3-carboxamide |
| SMILES | CCCCC(CCC)NC(=O)c1n[nH]c(CC)n1 |
| InChI | InChI=1S/C13H24N4O/c1-4-7-9-10(8-5-2)14-13(18)12-15-11(6-3)16-17-12/h10H,4-9H2,1-3H3,(H,14,18)(H,15,16,17) |
| InChIKey | RXRIPWGHSUHDQF-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |