C9H9ClN2O3S — CID 112674391
(E)-N-(2-amino-2-oxoethoxy)-3-(5-chlorothiophen-2-yl)prop-2-enamide (PubChem CID 112674391) has the molecular formula C9H9ClN2O3S and a molecular weight of 260.70 g/mol. Its IUPAC name is (E)-N-(2-amino-2-oxoethoxy)-3-(5-chlorothiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(2-amino-2-oxoethoxy)-3-(5-chlorothiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 112674391 |
| Molecular Formula | C9H9ClN2O3S |
| Molecular Weight | 260.70 g/mol |
| Exact Mass | 260.00 |
| IUPAC Name | (E)-N-(2-amino-2-oxoethoxy)-3-(5-chlorothiophen-2-yl)prop-2-enamide |
| SMILES | NC(=O)CONC(=O)/C=C/c1ccc(Cl)s1 |
| InChI | InChI=1S/C9H9ClN2O3S/c10-7-3-1-6(16-7)2-4-9(14)12-15-5-8(11)13/h1-4H,5H2,(H2,11,13)(H,12,14)/b4-2+ |
| InChIKey | WARRMITUBFISNA-DUXPYHPUSA-N |
| XLogP | 0.95 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.70 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|